C14H24N4O2 — CID 102409774
4,12-dimethyl-1,5,9,13-tetrazacyclohexadeca-4,12-diene-2,10-dione (PubChem CID 102409774) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 4,12-dimethyl-1,5,9,13-tetrazacyclohexadeca-4,12-diene-2,10-dione.
| Compound Name | 4,12-dimethyl-1,5,9,13-tetrazacyclohexadeca-4,12-diene-2,10-dione |
|---|---|
| PubChem CID | 102409774 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 4,12-dimethyl-1,5,9,13-tetrazacyclohexadeca-4,12-diene-2,10-dione |
| SMILES | C/C1=N/CCCNC(=O)C/C(C)=N/CCCNC(=O)C1 |
| InChI | InChI=1S/C14H24N4O2/c1-11-9-13(19)17-8-4-6-16-12(2)10-14(20)18-7-3-5-15-11/h3-10H2,1-2H3,(H,17,19)(H,18,20)/b15-11-,16-12+ |
| InChIKey | PBBRMPAYYPJCCL-UKVBVZPVSA-N |
| XLogP | 0.71 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |