About sodium 2-ethylhexyl 3-oxidoperoxysulfanylpentanoate
sodium 2-ethylhexyl 3-oxidoperoxysulfanylpentanoate (PubChem CID 20648049) has the molecular formula C13H25NaO5S
and a molecular weight of 316.40 g/mol. Its IUPAC name is sodium 2-ethylhexyl 3-oxidoperoxysulfanylpentanoate.
Molecular Properties
| Compound Name | sodium 2-ethylhexyl 3-oxidoperoxysulfanylpentanoate |
| PubChem CID | 20648049 |
| Molecular Formula | C13H25NaO5S |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | sodium 2-ethylhexyl 3-oxidoperoxysulfanylpentanoate |
| SMILES | CCCCC(CC)COC(=O)CC(CC)SOO[O-].[Na+] |
| InChI | InChI=1S/C13H26O5S.Na/c1-4-7-8-11(5-2)10-16-13(14)9-12(6-3)19-18-17-15;/h11-12,15H,4-10H2,1-3H3;/q;+1/p-1 |
| InChIKey | YFDHOEZDBPLCHP-UHFFFAOYSA-M |
| XLogP | -0.21 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-ethylhexyl 3-oxidoperoxysulfanylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-ethylhexyl 3-oxidoperoxysulfanylpentanoate?
The IUPAC name of sodium 2-ethylhexyl 3-oxidoperoxysulfanylpentanoate (CID 20648049) is sodium 2-ethylhexyl 3-oxidoperoxysulfanylpentanoate.
What is the SMILES notation for sodium 2-ethylhexyl 3-oxidoperoxysulfanylpentanoate?
The canonical SMILES for sodium 2-ethylhexyl 3-oxidoperoxysulfanylpentanoate is CCCCC(CC)COC(=O)CC(CC)SOO[O-].[Na+].
What is the InChIKey of sodium 2-ethylhexyl 3-oxidoperoxysulfanylpentanoate?
The InChIKey is YFDHOEZDBPLCHP-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H26O5S.Na/c1-4-7-8-11(5-2)10-16-13(14)9-12(6-3)19-18-17-15;/h11-12,15H,4-10H2,1-3H3;/q;+1/p-1.
What are the key properties of sodium 2-ethylhexyl 3-oxidoperoxysulfanylpentanoate?
sodium 2-ethylhexyl 3-oxidoperoxysulfanylpentanoate has a molecular weight of 316.40 g/mol, XLogP of -0.21, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-ethylhexyl 3-oxidoperoxysulfanylpentanoate is sourced from PubChem (CID 20648049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).