C43H26Cl2N2O7 — CID 20648404
2,5-dichloro-4-(dihydroxymethyl)-3-(3-hydroxy-6-oxo-2,7-diphenyl-4,5-dipyridin-3-ylxanthen-9-yl)benzoic acid (PubChem CID 20648404) has the molecular formula C43H26Cl2N2O7 and a molecular weight of 753.59 g/mol. Its IUPAC name is 2,5-dichloro-4-(dihydroxymethyl)-3-(3-hydroxy-6-oxo-2,7-diphenyl-4,5-dipyridin-3-ylxanthen-9-yl)benzoic acid.
| Compound Name | 2,5-dichloro-4-(dihydroxymethyl)-3-(3-hydroxy-6-oxo-2,7-diphenyl-4,5-dipyridin-3-ylxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 20648404 |
| Molecular Formula | C43H26Cl2N2O7 |
| Molecular Weight | 753.59 g/mol |
| Exact Mass | 752.11 |
| IUPAC Name | 2,5-dichloro-4-(dihydroxymethyl)-3-(3-hydroxy-6-oxo-2,7-diphenyl-4,5-dipyridin-3-ylxanthen-9-yl)benzoic acid |
| SMILES | O=C(O)c1cc(Cl)c(C(O)O)c(-c2c3cc(-c4ccccc4)c(=O)c(-c4cccnc4)c-3oc3c(-c4cccnc4)c(O)c(-c4ccccc4)cc23)c1Cl |
| InChI | InChI=1S/C43H26Cl2N2O7/c44-31-19-30(42(50)51)37(45)36(35(31)43(52)53)34-28-17-26(22-9-3-1-4-10-22)38(48)32(24-13-7-15-46-20-24)40(28)54-41-29(34)18-27(23-11-5-2-6-12-23)39(49)33(41)25-14-8-16-47-21-25/h1-21,43,48,52-53H,(H,50,51) |
| InChIKey | UPFDBYGGBRISGA-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 153.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.59 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|