C25H23N3O3S — CID 20649014
2-[[2-(2-methylphenyl)-4-(2-pyrimidin-5-ylethynyl)benzoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 20649014) has the molecular formula C25H23N3O3S and a molecular weight of 445.54 g/mol. Its IUPAC name is 2-[[2-(2-methylphenyl)-4-(2-pyrimidin-5-ylethynyl)benzoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[2-(2-methylphenyl)-4-(2-pyrimidin-5-ylethynyl)benzoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 20649014 |
| Molecular Formula | C25H23N3O3S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 2-[[2-(2-methylphenyl)-4-(2-pyrimidin-5-ylethynyl)benzoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)c1ccc(C#Cc2cncnc2)cc1-c1ccccc1C)C(=O)O |
| InChI | InChI=1S/C25H23N3O3S/c1-17-5-3-4-6-20(17)22-13-18(7-8-19-14-26-16-27-15-19)9-10-21(22)24(29)28-23(25(30)31)11-12-32-2/h3-6,9-10,13-16,23H,11-12H2,1-2H3,(H,28,29)(H,30,31) |
| InChIKey | DNXASXAHGPXOAK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|