C22H30FN3O2S2 — CID 20651603
N-[4-[[(13-fluoro-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaen-4-yl)amino]methyl]cyclohexyl]propane-2-sulfonamide (PubChem CID 20651603) has the molecular formula C22H30FN3O2S2 and a molecular weight of 451.63 g/mol. Its IUPAC name is N-[4-[[(13-fluoro-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaen-4-yl)amino]methyl]cyclohexyl]propane-2-sulfonamide.
| Compound Name | N-[4-[[(13-fluoro-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaen-4-yl)amino]methyl]cyclohexyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 20651603 |
| Molecular Formula | C22H30FN3O2S2 |
| Molecular Weight | 451.63 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | N-[4-[[(13-fluoro-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaen-4-yl)amino]methyl]cyclohexyl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)NC1CCC(CNc2nc3c(s2)CCCc2ccc(F)cc2-3)CC1 |
| InChI | InChI=1S/C22H30FN3O2S2/c1-14(2)30(27,28)26-18-10-6-15(7-11-18)13-24-22-25-21-19-12-17(23)9-8-16(19)4-3-5-20(21)29-22/h8-9,12,14-15,18,26H,3-7,10-11,13H2,1-2H3,(H,24,25) |
| InChIKey | OGEXXEMBYIBFSR-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.63 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |