C17H22FN3O2S2 — CID 90893238
13-fluoro-4-[4-[methyl(sulfino)amino]butylamino]-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaene (PubChem CID 90893238) has the molecular formula C17H22FN3O2S2 and a molecular weight of 383.51 g/mol. Its IUPAC name is 13-fluoro-4-[4-[methyl(sulfino)amino]butylamino]-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaene.
| Compound Name | 13-fluoro-4-[4-[methyl(sulfino)amino]butylamino]-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaene |
|---|---|
| PubChem CID | 90893238 |
| Molecular Formula | C17H22FN3O2S2 |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 13-fluoro-4-[4-[methyl(sulfino)amino]butylamino]-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaene |
| SMILES | CN(CCCCNc1nc2c(s1)CCCc1ccc(F)cc1-2)S(=O)O |
| InChI | InChI=1S/C17H22FN3O2S2/c1-21(25(22)23)10-3-2-9-19-17-20-16-14-11-13(18)8-7-12(14)5-4-6-15(16)24-17/h7-8,11H,2-6,9-10H2,1H3,(H,19,20)(H,22,23) |
| InChIKey | LQLMGCVOMWLHIP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|