C21H28FN3O2S — CID 87830134
tert-butyl N-[4-[(13-fluoro-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaen-4-yl)amino]butyl]carbamate (PubChem CID 87830134) has the molecular formula C21H28FN3O2S and a molecular weight of 405.54 g/mol. Its IUPAC name is tert-butyl N-[4-[(13-fluoro-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaen-4-yl)amino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[(13-fluoro-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaen-4-yl)amino]butyl]carbamate |
|---|---|
| PubChem CID | 87830134 |
| Molecular Formula | C21H28FN3O2S |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | tert-butyl N-[4-[(13-fluoro-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaen-4-yl)amino]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCNc1nc2c(s1)CCCc1ccc(F)cc1-2 |
| InChI | InChI=1S/C21H28FN3O2S/c1-21(2,3)27-20(26)24-12-5-4-11-23-19-25-18-16-13-15(22)10-9-14(16)7-6-8-17(18)28-19/h9-10,13H,4-8,11-12H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | DOTHLXVRSWQFFT-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|