C22H30FN3O2S — CID 22000408
tert-butyl N-[5-[(13-fluoro-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaen-4-yl)amino]pentyl]carbamate (PubChem CID 22000408) has the molecular formula C22H30FN3O2S and a molecular weight of 419.57 g/mol. Its IUPAC name is tert-butyl N-[5-[(13-fluoro-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaen-4-yl)amino]pentyl]carbamate.
| Compound Name | tert-butyl N-[5-[(13-fluoro-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaen-4-yl)amino]pentyl]carbamate |
|---|---|
| PubChem CID | 22000408 |
| Molecular Formula | C22H30FN3O2S |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | tert-butyl N-[5-[(13-fluoro-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaen-4-yl)amino]pentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCNc1nc2c(s1)CCCc1ccc(F)cc1-2 |
| InChI | InChI=1S/C22H30FN3O2S/c1-22(2,3)28-21(27)25-13-6-4-5-12-24-20-26-19-17-14-16(23)11-10-15(17)8-7-9-18(19)29-20/h10-11,14H,4-9,12-13H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | UQTMKUNXZQXTLY-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|