C22H27ClFN3O2S — CID 87263777
2-chloroethyl-[[4-[(13-fluoro-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaen-4-yl)amino]cyclohexyl]methyl]carbamic acid (PubChem CID 87263777) has the molecular formula C22H27ClFN3O2S and a molecular weight of 452.00 g/mol. Its IUPAC name is 2-chloroethyl-[[4-[(13-fluoro-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaen-4-yl)amino]cyclohexyl]methyl]carbamic acid.
| Compound Name | 2-chloroethyl-[[4-[(13-fluoro-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaen-4-yl)amino]cyclohexyl]methyl]carbamic acid |
|---|---|
| PubChem CID | 87263777 |
| Molecular Formula | C22H27ClFN3O2S |
| Molecular Weight | 452.00 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 2-chloroethyl-[[4-[(13-fluoro-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaen-4-yl)amino]cyclohexyl]methyl]carbamic acid |
| SMILES | O=C(O)N(CCCl)CC1CCC(Nc2nc3c(s2)CCCc2ccc(F)cc2-3)CC1 |
| InChI | InChI=1S/C22H27ClFN3O2S/c23-10-11-27(22(28)29)13-14-4-8-17(9-5-14)25-21-26-20-18-12-16(24)7-6-15(18)2-1-3-19(20)30-21/h6-7,12,14,17H,1-5,8-11,13H2,(H,25,26)(H,28,29) |
| InChIKey | MRTHQSXCCDVZIL-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.00 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|