C46H34N6 — CID 20652071
2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9-ethyl-9-methylfluoren-2-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 20652071) has the molecular formula C46H34N6 and a molecular weight of 670.82 g/mol. Its IUPAC name is 2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9-ethyl-9-methylfluoren-2-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9-ethyl-9-methylfluoren-2-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 20652071 |
| Molecular Formula | C46H34N6 |
| Molecular Weight | 670.82 g/mol |
| Exact Mass | 670.28 |
| IUPAC Name | 2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9-ethyl-9-methylfluoren-2-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | CCC1(C)c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc2-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc21 |
| InChI | InChI=1S/C46H34N6/c1-3-46(2)38-28-34(44-49-40(30-16-8-4-9-17-30)47-41(50-44)31-18-10-5-11-19-31)24-26-36(38)37-27-25-35(29-39(37)46)45-51-42(32-20-12-6-13-21-32)48-43(52-45)33-22-14-7-15-23-33/h4-29H,3H2,1-2H3 |
| InChIKey | LJYQYYGTABVRNW-UHFFFAOYSA-N |
| XLogP | 10.76 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.82 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |