C18H23F5O2 — CID 20656707
2-[4-[3,5-difluoro-4-(trifluoromethyl)phenyl]butyl]-5-propyl-1,3-dioxane (PubChem CID 20656707) has the molecular formula C18H23F5O2 and a molecular weight of 366.37 g/mol. Its IUPAC name is 2-[4-[3,5-difluoro-4-(trifluoromethyl)phenyl]butyl]-5-propyl-1,3-dioxane.
| Compound Name | 2-[4-[3,5-difluoro-4-(trifluoromethyl)phenyl]butyl]-5-propyl-1,3-dioxane |
|---|---|
| PubChem CID | 20656707 |
| Molecular Formula | C18H23F5O2 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 2-[4-[3,5-difluoro-4-(trifluoromethyl)phenyl]butyl]-5-propyl-1,3-dioxane |
| SMILES | CCCC1COC(CCCCc2cc(F)c(C(F)(F)F)c(F)c2)OC1 |
| InChI | InChI=1S/C18H23F5O2/c1-2-5-13-10-24-16(25-11-13)7-4-3-6-12-8-14(19)17(15(20)9-12)18(21,22)23/h8-9,13,16H,2-7,10-11H2,1H3 |
| InChIKey | CHSWCTKKQTVQRF-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|