C9H8Br2N2OS — CID 20660384
5,7-dibromo-2-ethyl-3-methoxythieno[3,4-b]pyrazine (PubChem CID 20660384) has the molecular formula C9H8Br2N2OS and a molecular weight of 352.05 g/mol. Its IUPAC name is 5,7-dibromo-2-ethyl-3-methoxythieno[3,4-b]pyrazine.
| Compound Name | 5,7-dibromo-2-ethyl-3-methoxythieno[3,4-b]pyrazine |
|---|---|
| PubChem CID | 20660384 |
| Molecular Formula | C9H8Br2N2OS |
| Molecular Weight | 352.05 g/mol |
| Exact Mass | 349.87 |
| IUPAC Name | 5,7-dibromo-2-ethyl-3-methoxythieno[3,4-b]pyrazine |
| SMILES | CCc1nc2c(Br)sc(Br)c2nc1OC |
| InChI | InChI=1S/C9H8Br2N2OS/c1-3-4-9(14-2)13-6-5(12-4)7(10)15-8(6)11/h3H2,1-2H3 |
| InChIKey | UGDRTTSOZSAHHN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.05 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |