C15H18ClN5O2S — CID 20663965
2-(4-chloro-7-piperidin-1-ylsulfonylisoquinolin-1-yl)guanidine (PubChem CID 20663965) has the molecular formula C15H18ClN5O2S and a molecular weight of 367.86 g/mol. Its IUPAC name is 2-(4-chloro-7-piperidin-1-ylsulfonylisoquinolin-1-yl)guanidine.
| Compound Name | 2-(4-chloro-7-piperidin-1-ylsulfonylisoquinolin-1-yl)guanidine |
|---|---|
| PubChem CID | 20663965 |
| Molecular Formula | C15H18ClN5O2S |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 2-(4-chloro-7-piperidin-1-ylsulfonylisoquinolin-1-yl)guanidine |
| SMILES | NC(N)=Nc1ncc(Cl)c2ccc(S(=O)(=O)N3CCCCC3)cc12 |
| InChI | InChI=1S/C15H18ClN5O2S/c16-13-9-19-14(20-15(17)18)12-8-10(4-5-11(12)13)24(22,23)21-6-2-1-3-7-21/h4-5,8-9H,1-3,6-7H2,(H4,17,18,19,20) |
| InChIKey | XRZLHIHIYSPKMM-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|