C10H20O2 — CID 20665553
3-methoxy-2,4,5,6-tetramethyloxane (PubChem CID 20665553) has the molecular formula C10H20O2 and a molecular weight of 172.27 g/mol. Its IUPAC name is 3-methoxy-2,4,5,6-tetramethyloxane.
| Compound Name | 3-methoxy-2,4,5,6-tetramethyloxane |
|---|---|
| PubChem CID | 20665553 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | 3-methoxy-2,4,5,6-tetramethyloxane |
| SMILES | COC1C(C)OC(C)C(C)C1C |
| InChI | InChI=1S/C10H20O2/c1-6-7(2)10(11-5)9(4)12-8(6)3/h6-10H,1-5H3 |
| InChIKey | PIJVAEUIBQEZNL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |