C19H22Cl2N2O5S — CID 20665663
[2-[(3,5-dichloro-4-hydroxy-2-methylphenyl)sulfamoyl]-3,5-dimethylphenyl] N-propylcarbamate (PubChem CID 20665663) has the molecular formula C19H22Cl2N2O5S and a molecular weight of 461.37 g/mol. Its IUPAC name is [2-[(3,5-dichloro-4-hydroxy-2-methylphenyl)sulfamoyl]-3,5-dimethylphenyl] N-propylcarbamate.
| Compound Name | [2-[(3,5-dichloro-4-hydroxy-2-methylphenyl)sulfamoyl]-3,5-dimethylphenyl] N-propylcarbamate |
|---|---|
| PubChem CID | 20665663 |
| Molecular Formula | C19H22Cl2N2O5S |
| Molecular Weight | 461.37 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | [2-[(3,5-dichloro-4-hydroxy-2-methylphenyl)sulfamoyl]-3,5-dimethylphenyl] N-propylcarbamate |
| SMILES | CCCNC(=O)Oc1cc(C)cc(C)c1S(=O)(=O)Nc1cc(Cl)c(O)c(Cl)c1C |
| InChI | InChI=1S/C19H22Cl2N2O5S/c1-5-6-22-19(25)28-15-8-10(2)7-11(3)18(15)29(26,27)23-14-9-13(20)17(24)16(21)12(14)4/h7-9,23-24H,5-6H2,1-4H3,(H,22,25) |
| InChIKey | CVKYOCBAEFTNPU-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.37 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|