C35H42Cl2N2O6S2 — CID 54074003
N-(3-chloro-4-hydroxy-2,5-dimethylphenyl)-2,3,5,6-tetramethylbenzenesulfonamide;N-(3-chloro-4-hydroxy-2,5-dimethylphenyl)-2,4,6-trimethylbenzenesulfonamide (PubChem CID 54074003) has the molecular formula C35H42Cl2N2O6S2 and a molecular weight of 721.77 g/mol. Its IUPAC name is N-(3-chloro-4-hydroxy-2,5-dimethylphenyl)-2,3,5,6-tetramethylbenzenesulfonamide;N-(3-chloro-4-hydroxy-2,5-dimethylphenyl)-2,4,6-trimethylbenzenesulfonamide.
| Compound Name | N-(3-chloro-4-hydroxy-2,5-dimethylphenyl)-2,3,5,6-tetramethylbenzenesulfonamide;N-(3-chloro-4-hydroxy-2,5-dimethylphenyl)-2,4,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 54074003 |
| Molecular Formula | C35H42Cl2N2O6S2 |
| Molecular Weight | 721.77 g/mol |
| Exact Mass | 720.19 |
| IUPAC Name | N-(3-chloro-4-hydroxy-2,5-dimethylphenyl)-2,3,5,6-tetramethylbenzenesulfonamide;N-(3-chloro-4-hydroxy-2,5-dimethylphenyl)-2,4,6-trimethylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)Nc2cc(C)c(O)c(Cl)c2C)c1C.Cc1cc(C)c(S(=O)(=O)Nc2cc(C)c(O)c(Cl)c2C)c(C)c1 |
| InChI | InChI=1S/C18H22ClNO3S.C17H20ClNO3S/c1-9-7-10(2)13(5)18(12(9)4)24(22,23)20-15-8-11(3)17(21)16(19)14(15)6;1-9-6-11(3)17(12(4)7-9)23(21,22)19-14-8-10(2)16(20)15(18)13(14)5/h7-8,20-21H,1-6H3;6-8,19-20H,1-5H3 |
| InChIKey | MIKUQGORYDICDN-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.77 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|