C16H25O5P — CID 20668785
methyl 2-(8,8a-dimethyl-3-oxo-7-phosphanyloxy-1,2,5,6,7,8-hexahydronaphthalen-2-yl)-2-hydroxypropanoate (PubChem CID 20668785) has the molecular formula C16H25O5P and a molecular weight of 328.35 g/mol. Its IUPAC name is methyl 2-(8,8a-dimethyl-3-oxo-7-phosphanyloxy-1,2,5,6,7,8-hexahydronaphthalen-2-yl)-2-hydroxypropanoate.
| Compound Name | methyl 2-(8,8a-dimethyl-3-oxo-7-phosphanyloxy-1,2,5,6,7,8-hexahydronaphthalen-2-yl)-2-hydroxypropanoate |
|---|---|
| PubChem CID | 20668785 |
| Molecular Formula | C16H25O5P |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | methyl 2-(8,8a-dimethyl-3-oxo-7-phosphanyloxy-1,2,5,6,7,8-hexahydronaphthalen-2-yl)-2-hydroxypropanoate |
| SMILES | COC(=O)C(C)(O)C1CC2(C)C(=CC1=O)CCC(OP)C2C |
| InChI | InChI=1S/C16H25O5P/c1-9-13(21-22)6-5-10-7-12(17)11(8-15(9,10)2)16(3,19)14(18)20-4/h7,9,11,13,19H,5-6,8,22H2,1-4H3 |
| InChIKey | BQMLZUYYXBJHCT-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|