C27H25N6O3+ — CID 20669770
N-(1-benzylpyridin-1-ium-4-yl)-2-oxo-2-[2-[4-(phenylcarbamoylamino)phenyl]hydrazinyl]acetamide (PubChem CID 20669770) has the molecular formula C27H25N6O3+ and a molecular weight of 481.54 g/mol. Its IUPAC name is N-(1-benzylpyridin-1-ium-4-yl)-2-oxo-2-[2-[4-(phenylcarbamoylamino)phenyl]hydrazinyl]acetamide.
| Compound Name | N-(1-benzylpyridin-1-ium-4-yl)-2-oxo-2-[2-[4-(phenylcarbamoylamino)phenyl]hydrazinyl]acetamide |
|---|---|
| PubChem CID | 20669770 |
| Molecular Formula | C27H25N6O3+ |
| Molecular Weight | 481.54 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | N-(1-benzylpyridin-1-ium-4-yl)-2-oxo-2-[2-[4-(phenylcarbamoylamino)phenyl]hydrazinyl]acetamide |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(NNC(=O)C(=O)Nc2cc[n+](Cc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C27H24N6O3/c34-25(28-23-15-17-33(18-16-23)19-20-7-3-1-4-8-20)26(35)32-31-24-13-11-22(12-14-24)30-27(36)29-21-9-5-2-6-10-21/h1-18H,19H2,(H4,29,30,31,32,34,35,36)/p+1 |
| InChIKey | CSQRCQWQAWSATN-UHFFFAOYSA-O |
| XLogP | 3.75 |
| TPSA | 115.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.54 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|