C20H20ClN5O2 — CID 20670686
1-(2-chloro-4,5-dicyanoanilino)-3-[(2,4-diethylphenoxy)methyl]urea (PubChem CID 20670686) has the molecular formula C20H20ClN5O2 and a molecular weight of 397.87 g/mol. Its IUPAC name is 1-(2-chloro-4,5-dicyanoanilino)-3-[(2,4-diethylphenoxy)methyl]urea.
| Compound Name | 1-(2-chloro-4,5-dicyanoanilino)-3-[(2,4-diethylphenoxy)methyl]urea |
|---|---|
| PubChem CID | 20670686 |
| Molecular Formula | C20H20ClN5O2 |
| Molecular Weight | 397.87 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 1-(2-chloro-4,5-dicyanoanilino)-3-[(2,4-diethylphenoxy)methyl]urea |
| SMILES | CCc1ccc(OCNC(=O)NNc2cc(C#N)c(C#N)cc2Cl)c(CC)c1 |
| InChI | InChI=1S/C20H20ClN5O2/c1-3-13-5-6-19(14(4-2)7-13)28-12-24-20(27)26-25-18-9-16(11-23)15(10-22)8-17(18)21/h5-9,25H,3-4,12H2,1-2H3,(H2,24,26,27) |
| InChIKey | RPBPXVZHDGAGBO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 109.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.87 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|