C21H23N5O2 — CID 20670689
1-(4,5-dicyano-2-methylanilino)-3-[(2,4-diethylphenoxy)methyl]urea (PubChem CID 20670689) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is 1-(4,5-dicyano-2-methylanilino)-3-[(2,4-diethylphenoxy)methyl]urea.
| Compound Name | 1-(4,5-dicyano-2-methylanilino)-3-[(2,4-diethylphenoxy)methyl]urea |
|---|---|
| PubChem CID | 20670689 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 1-(4,5-dicyano-2-methylanilino)-3-[(2,4-diethylphenoxy)methyl]urea |
| SMILES | CCc1ccc(OCNC(=O)NNc2cc(C#N)c(C#N)cc2C)c(CC)c1 |
| InChI | InChI=1S/C21H23N5O2/c1-4-15-6-7-20(16(5-2)9-15)28-13-24-21(27)26-25-19-10-18(12-23)17(11-22)8-14(19)3/h6-10,25H,4-5,13H2,1-3H3,(H2,24,26,27) |
| InChIKey | GGRWFGRTFNCPSR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 109.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|