C32H43F3N2 — CID 20670696
4-[[2-octyl-5-(2,4,4-trimethylpentan-2-yl)phenyl]methyl]-2-(trifluoromethyl)quinazoline (PubChem CID 20670696) has the molecular formula C32H43F3N2 and a molecular weight of 512.70 g/mol. Its IUPAC name is 4-[[2-octyl-5-(2,4,4-trimethylpentan-2-yl)phenyl]methyl]-2-(trifluoromethyl)quinazoline.
| Compound Name | 4-[[2-octyl-5-(2,4,4-trimethylpentan-2-yl)phenyl]methyl]-2-(trifluoromethyl)quinazoline |
|---|---|
| PubChem CID | 20670696 |
| Molecular Formula | C32H43F3N2 |
| Molecular Weight | 512.70 g/mol |
| Exact Mass | 512.34 |
| IUPAC Name | 4-[[2-octyl-5-(2,4,4-trimethylpentan-2-yl)phenyl]methyl]-2-(trifluoromethyl)quinazoline |
| SMILES | CCCCCCCCc1ccc(C(C)(C)CC(C)(C)C)cc1Cc1nc(C(F)(F)F)nc2ccccc12 |
| InChI | InChI=1S/C32H43F3N2/c1-7-8-9-10-11-12-15-23-18-19-25(31(5,6)22-30(2,3)4)20-24(23)21-28-26-16-13-14-17-27(26)36-29(37-28)32(33,34)35/h13-14,16-20H,7-12,15,21-22H2,1-6H3 |
| InChIKey | UCNCOWUONVQJDZ-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.70 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|