C8H11NO — CID 20671440
1,2,5-trimethylpyridin-4-one (PubChem CID 20671440) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is 1,2,5-trimethylpyridin-4-one.
| Compound Name | 1,2,5-trimethylpyridin-4-one |
|---|---|
| PubChem CID | 20671440 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 1,2,5-trimethylpyridin-4-one |
| SMILES | Cc1cn(C)c(C)cc1=O |
| InChI | InChI=1S/C8H11NO/c1-6-5-9(3)7(2)4-8(6)10/h4-5H,1-3H3 |
| InChIKey | BZFUIEUJIQYMTH-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |