C13H11O2P — CID 20673842
6-methylbenzo[d][1,3,2]benzodioxaphosphepine (PubChem CID 20673842) has the molecular formula C13H11O2P and a molecular weight of 230.20 g/mol. Its IUPAC name is 6-methylbenzo[d][1,3,2]benzodioxaphosphepine.
| Compound Name | 6-methylbenzo[d][1,3,2]benzodioxaphosphepine |
|---|---|
| PubChem CID | 20673842 |
| Molecular Formula | C13H11O2P |
| Molecular Weight | 230.20 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 6-methylbenzo[d][1,3,2]benzodioxaphosphepine |
| SMILES | Cp1oc2ccccc2c2ccccc2o1 |
| InChI | InChI=1S/C13H11O2P/c1-16-14-12-8-4-2-6-10(12)11-7-3-5-9-13(11)15-16/h2-9H,1H3 |
| InChIKey | MEXIIHUMGIKGNN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.20 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |