C18H9F17O4 — CID 20678084
[4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctoxy)-3-hydroxyphenyl]methyl prop-2-enoate (PubChem CID 20678084) has the molecular formula C18H9F17O4 and a molecular weight of 612.23 g/mol. Its IUPAC name is [4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctoxy)-3-hydroxyphenyl]methyl prop-2-enoate.
| Compound Name | [4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctoxy)-3-hydroxyphenyl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 20678084 |
| Molecular Formula | C18H9F17O4 |
| Molecular Weight | 612.23 g/mol |
| Exact Mass | 612.02 |
| IUPAC Name | [4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctoxy)-3-hydroxyphenyl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCc1ccc(OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(O)c1 |
| InChI | InChI=1S/C18H9F17O4/c1-2-10(37)38-6-7-3-4-9(8(36)5-7)39-18(34,35)16(29,30)14(25,26)12(21,22)11(19,20)13(23,24)15(27,28)17(31,32)33/h2-5,36H,1,6H2 |
| InChIKey | AMUOZMRRGMFPKM-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.23 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|