C31H47N3O9S — CID 20678422
N-[3-[3,3-dibutyl-7-(dimethylamino)-4-hydroxy-1,1-dioxo-2,5-dihydro-1λ6,4-benzothiazepin-5-yl]phenyl]-2,3,4,5,6-pentahydroxyhexanamide (PubChem CID 20678422) has the molecular formula C31H47N3O9S and a molecular weight of 637.80 g/mol. Its IUPAC name is N-[3-[3,3-dibutyl-7-(dimethylamino)-4-hydroxy-1,1-dioxo-2,5-dihydro-1λ6,4-benzothiazepin-5-yl]phenyl]-2,3,4,5,6-pentahydroxyhexanamide.
| Compound Name | N-[3-[3,3-dibutyl-7-(dimethylamino)-4-hydroxy-1,1-dioxo-2,5-dihydro-1λ6,4-benzothiazepin-5-yl]phenyl]-2,3,4,5,6-pentahydroxyhexanamide |
|---|---|
| PubChem CID | 20678422 |
| Molecular Formula | C31H47N3O9S |
| Molecular Weight | 637.80 g/mol |
| Exact Mass | 637.30 |
| IUPAC Name | N-[3-[3,3-dibutyl-7-(dimethylamino)-4-hydroxy-1,1-dioxo-2,5-dihydro-1λ6,4-benzothiazepin-5-yl]phenyl]-2,3,4,5,6-pentahydroxyhexanamide |
| SMILES | CCCCC1(CCCC)CS(=O)(=O)c2ccc(N(C)C)cc2C(c2cccc(NC(=O)C(O)C(O)C(O)C(O)CO)c2)N1O |
| InChI | InChI=1S/C31H47N3O9S/c1-5-7-14-31(15-8-6-2)19-44(42,43)25-13-12-22(33(3)4)17-23(25)26(34(31)41)20-10-9-11-21(16-20)32-30(40)29(39)28(38)27(37)24(36)18-35/h9-13,16-17,24,26-29,35-39,41H,5-8,14-15,18-19H2,1-4H3,(H,32,40) |
| InChIKey | WMIAFCBDQMXVPD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 191.10 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.80 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |