C33H52N4O7S — CID 163916444
1-[3-[(5R)-3,3-dibutyl-7-(dimethylamino)-1,1-dioxo-4,5-dihydro-2H-1λ6,4-benzothiazepin-5-yl]phenyl]-3-[(2R,3R,4S,5R)-2,4,5,6-tetrahydroxy-3-methylhexyl]urea (PubChem CID 163916444) has the molecular formula C33H52N4O7S and a molecular weight of 648.87 g/mol. Its IUPAC name is 1-[3-[(5R)-3,3-dibutyl-7-(dimethylamino)-1,1-dioxo-4,5-dihydro-2H-1λ6,4-benzothiazepin-5-yl]phenyl]-3-[(2R,3R,4S,5R)-2,4,5,6-tetrahydroxy-3-methylhexyl]urea.
| Compound Name | 1-[3-[(5R)-3,3-dibutyl-7-(dimethylamino)-1,1-dioxo-4,5-dihydro-2H-1λ6,4-benzothiazepin-5-yl]phenyl]-3-[(2R,3R,4S,5R)-2,4,5,6-tetrahydroxy-3-methylhexyl]urea |
|---|---|
| PubChem CID | 163916444 |
| Molecular Formula | C33H52N4O7S |
| Molecular Weight | 648.87 g/mol |
| Exact Mass | 648.36 |
| IUPAC Name | 1-[3-[(5R)-3,3-dibutyl-7-(dimethylamino)-1,1-dioxo-4,5-dihydro-2H-1λ6,4-benzothiazepin-5-yl]phenyl]-3-[(2R,3R,4S,5R)-2,4,5,6-tetrahydroxy-3-methylhexyl]urea |
| SMILES | CCCCC1(CCCC)CS(=O)(=O)c2ccc(N(C)C)cc2[C@@H](c2cccc(NC(=O)NC[C@H](O)[C@@H](C)[C@H](O)[C@H](O)CO)c2)N1 |
| InChI | InChI=1S/C33H52N4O7S/c1-6-8-15-33(16-9-7-2)21-45(43,44)29-14-13-25(37(4)5)18-26(29)30(36-33)23-11-10-12-24(17-23)35-32(42)34-19-27(39)22(3)31(41)28(40)20-38/h10-14,17-18,22,27-28,30-31,36,38-41H,6-9,15-16,19-21H2,1-5H3,(H2,34,35,42)/t22-,27+,28-,30-,31+/m1/s1 |
| InChIKey | QWRBKUTXTUJPAK-SHQUAMPASA-N |
| XLogP | 3.17 |
| TPSA | 171.46 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.87 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |