C42H67BrN4O2S2 — CID 23154202
6-(1-azoniabicyclo[2.2.2]octan-1-yl)-N-[3-[7-(dimethylamino)-3,3-dihexyl-1,1-dioxo-4,5-dihydro-2H-1λ6,4-benzothiazepin-5-yl]phenyl]hexanethioamide bromide (PubChem CID 23154202) has the molecular formula C42H67BrN4O2S2 and a molecular weight of 804.06 g/mol. Its IUPAC name is 6-(1-azoniabicyclo[2.2.2]octan-1-yl)-N-[3-[7-(dimethylamino)-3,3-dihexyl-1,1-dioxo-4,5-dihydro-2H-1λ6,4-benzothiazepin-5-yl]phenyl]hexanethioamide bromide.
| Compound Name | 6-(1-azoniabicyclo[2.2.2]octan-1-yl)-N-[3-[7-(dimethylamino)-3,3-dihexyl-1,1-dioxo-4,5-dihydro-2H-1λ6,4-benzothiazepin-5-yl]phenyl]hexanethioamide bromide |
|---|---|
| PubChem CID | 23154202 |
| Molecular Formula | C42H67BrN4O2S2 |
| Molecular Weight | 804.06 g/mol |
| Exact Mass | 802.39 |
| IUPAC Name | 6-(1-azoniabicyclo[2.2.2]octan-1-yl)-N-[3-[7-(dimethylamino)-3,3-dihexyl-1,1-dioxo-4,5-dihydro-2H-1λ6,4-benzothiazepin-5-yl]phenyl]hexanethioamide bromide |
| SMILES | CCCCCCC1(CCCCCC)CS(=O)(=O)c2ccc(N(C)C)cc2C(c2cccc(NC(=S)CCCCC[N+]34CCC(CC3)CC4)c2)N1.[Br-] |
| InChI | InChI=1S/C42H66N4O2S2.BrH/c1-5-7-9-13-25-42(26-14-10-8-6-2)33-50(47,48)39-21-20-37(45(3)4)32-38(39)41(44-42)35-17-16-18-36(31-35)43-40(49)19-12-11-15-27-46-28-22-34(23-29-46)24-30-46;/h16-18,20-21,31-32,34,41,44H,5-15,19,22-30,33H2,1-4H3;1H |
| InChIKey | DKXGNBMVYATIQH-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.06 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|