C25H23NO7S — CID 20679974
(4-nitrophenyl)methyl 9,10-diethoxyanthracene-1-sulfonate (PubChem CID 20679974) has the molecular formula C25H23NO7S and a molecular weight of 481.53 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 9,10-diethoxyanthracene-1-sulfonate.
| Compound Name | (4-nitrophenyl)methyl 9,10-diethoxyanthracene-1-sulfonate |
|---|---|
| PubChem CID | 20679974 |
| Molecular Formula | C25H23NO7S |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | (4-nitrophenyl)methyl 9,10-diethoxyanthracene-1-sulfonate |
| SMILES | CCOc1c2ccccc2c(OCC)c2c(S(=O)(=O)OCc3ccc([N+](=O)[O-])cc3)cccc12 |
| InChI | InChI=1S/C25H23NO7S/c1-3-31-24-19-8-5-6-9-20(19)25(32-4-2)23-21(24)10-7-11-22(23)34(29,30)33-16-17-12-14-18(15-13-17)26(27)28/h5-15H,3-4,16H2,1-2H3 |
| InChIKey | SCFZEAOXWFEREG-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|