C25H23NO7S — CID 87199995
9,10-diethoxy-1-[(4-nitrophenyl)methyl]anthracene-2-sulfonic acid (PubChem CID 87199995) has the molecular formula C25H23NO7S and a molecular weight of 481.53 g/mol. Its IUPAC name is 9,10-diethoxy-1-[(4-nitrophenyl)methyl]anthracene-2-sulfonic acid.
| Compound Name | 9,10-diethoxy-1-[(4-nitrophenyl)methyl]anthracene-2-sulfonic acid |
|---|---|
| PubChem CID | 87199995 |
| Molecular Formula | C25H23NO7S |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | 9,10-diethoxy-1-[(4-nitrophenyl)methyl]anthracene-2-sulfonic acid |
| SMILES | CCOc1c2ccccc2c(OCC)c2c(Cc3ccc([N+](=O)[O-])cc3)c(S(=O)(=O)O)ccc12 |
| InChI | InChI=1S/C25H23NO7S/c1-3-32-24-18-7-5-6-8-19(18)25(33-4-2)23-20(24)13-14-22(34(29,30)31)21(23)15-16-9-11-17(12-10-16)26(27)28/h5-14H,3-4,15H2,1-2H3,(H,29,30,31) |
| InChIKey | ROSMRLPYRKRAGN-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|