C13H14O6 — CID 20686371
5-methoxycarbonyl-11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylic acid (PubChem CID 20686371) has the molecular formula C13H14O6 and a molecular weight of 266.25 g/mol. Its IUPAC name is 5-methoxycarbonyl-11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylic acid.
| Compound Name | 5-methoxycarbonyl-11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylic acid |
|---|---|
| PubChem CID | 20686371 |
| Molecular Formula | C13H14O6 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 5-methoxycarbonyl-11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylic acid |
| SMILES | COC(=O)C1C2OC(C1C(=O)O)C1C3C=CC(O3)C21 |
| InChI | InChI=1S/C13H14O6/c1-17-13(16)9-8(12(14)15)10-6-4-2-3-5(18-4)7(6)11(9)19-10/h2-11H,1H3,(H,14,15) |
| InChIKey | XFYQIKQXYBECBA-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|