About sodium (3,5-dimethyl-4-oxidoperoxysulfanylphenyl) 3-bromopropanoate
sodium (3,5-dimethyl-4-oxidoperoxysulfanylphenyl) 3-bromopropanoate (PubChem CID 20688554) has the molecular formula C11H12BrNaO5S
and a molecular weight of 359.17 g/mol. Its IUPAC name is sodium (3,5-dimethyl-4-oxidoperoxysulfanylphenyl) 3-bromopropanoate.
Molecular Properties
| Compound Name | sodium (3,5-dimethyl-4-oxidoperoxysulfanylphenyl) 3-bromopropanoate |
| PubChem CID | 20688554 |
| Molecular Formula | C11H12BrNaO5S |
| Molecular Weight | 359.17 g/mol |
| Exact Mass | 357.95 |
| IUPAC Name | sodium (3,5-dimethyl-4-oxidoperoxysulfanylphenyl) 3-bromopropanoate |
| SMILES | Cc1cc(OC(=O)CCBr)cc(C)c1SOO[O-].[Na+] |
| InChI | InChI=1S/C11H13BrO5S.Na/c1-7-5-9(15-10(13)3-4-12)6-8(2)11(7)18-17-16-14;/h5-6,14H,3-4H2,1-2H3;/q;+1/p-1 |
| InChIKey | LXCGIDKOOSYLDT-UHFFFAOYSA-M |
| XLogP | -0.77 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.17 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium (3,5-dimethyl-4-oxidoperoxysulfanylphenyl) 3-bromopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium (3,5-dimethyl-4-oxidoperoxysulfanylphenyl) 3-bromopropanoate?
The IUPAC name of sodium (3,5-dimethyl-4-oxidoperoxysulfanylphenyl) 3-bromopropanoate (CID 20688554) is sodium (3,5-dimethyl-4-oxidoperoxysulfanylphenyl) 3-bromopropanoate.
What is the SMILES notation for sodium (3,5-dimethyl-4-oxidoperoxysulfanylphenyl) 3-bromopropanoate?
The canonical SMILES for sodium (3,5-dimethyl-4-oxidoperoxysulfanylphenyl) 3-bromopropanoate is Cc1cc(OC(=O)CCBr)cc(C)c1SOO[O-].[Na+].
What is the InChIKey of sodium (3,5-dimethyl-4-oxidoperoxysulfanylphenyl) 3-bromopropanoate?
The InChIKey is LXCGIDKOOSYLDT-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H13BrO5S.Na/c1-7-5-9(15-10(13)3-4-12)6-8(2)11(7)18-17-16-14;/h5-6,14H,3-4H2,1-2H3;/q;+1/p-1.
What are the key properties of sodium (3,5-dimethyl-4-oxidoperoxysulfanylphenyl) 3-bromopropanoate?
sodium (3,5-dimethyl-4-oxidoperoxysulfanylphenyl) 3-bromopropanoate has a molecular weight of 359.17 g/mol, XLogP of -0.77, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium (3,5-dimethyl-4-oxidoperoxysulfanylphenyl) 3-bromopropanoate is sourced from PubChem (CID 20688554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).