About sodium (3-methyl-4-oxidoperoxysulfanylphenyl) 2-bromoethanesulfonate
sodium (3-methyl-4-oxidoperoxysulfanylphenyl) 2-bromoethanesulfonate (PubChem CID 20688431) has the molecular formula C9H10BrNaO6S2
and a molecular weight of 381.20 g/mol. Its IUPAC name is sodium (3-methyl-4-oxidoperoxysulfanylphenyl) 2-bromoethanesulfonate.
Molecular Properties
| Compound Name | sodium (3-methyl-4-oxidoperoxysulfanylphenyl) 2-bromoethanesulfonate |
| PubChem CID | 20688431 |
| Molecular Formula | C9H10BrNaO6S2 |
| Molecular Weight | 381.20 g/mol |
| Exact Mass | 379.90 |
| IUPAC Name | sodium (3-methyl-4-oxidoperoxysulfanylphenyl) 2-bromoethanesulfonate |
| SMILES | Cc1cc(OS(=O)(=O)CCBr)ccc1SOO[O-].[Na+] |
| InChI | InChI=1S/C9H11BrO6S2.Na/c1-7-6-8(14-18(12,13)5-4-10)2-3-9(7)17-16-15-11;/h2-3,6,11H,4-5H2,1H3;/q;+1/p-1 |
| InChIKey | RMRADVNNIPELQU-UHFFFAOYSA-M |
| XLogP | -1.67 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.20 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium (3-methyl-4-oxidoperoxysulfanylphenyl) 2-bromoethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium (3-methyl-4-oxidoperoxysulfanylphenyl) 2-bromoethanesulfonate?
The IUPAC name of sodium (3-methyl-4-oxidoperoxysulfanylphenyl) 2-bromoethanesulfonate (CID 20688431) is sodium (3-methyl-4-oxidoperoxysulfanylphenyl) 2-bromoethanesulfonate.
What is the SMILES notation for sodium (3-methyl-4-oxidoperoxysulfanylphenyl) 2-bromoethanesulfonate?
The canonical SMILES for sodium (3-methyl-4-oxidoperoxysulfanylphenyl) 2-bromoethanesulfonate is Cc1cc(OS(=O)(=O)CCBr)ccc1SOO[O-].[Na+].
What is the InChIKey of sodium (3-methyl-4-oxidoperoxysulfanylphenyl) 2-bromoethanesulfonate?
The InChIKey is RMRADVNNIPELQU-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H11BrO6S2.Na/c1-7-6-8(14-18(12,13)5-4-10)2-3-9(7)17-16-15-11;/h2-3,6,11H,4-5H2,1H3;/q;+1/p-1.
What are the key properties of sodium (3-methyl-4-oxidoperoxysulfanylphenyl) 2-bromoethanesulfonate?
sodium (3-methyl-4-oxidoperoxysulfanylphenyl) 2-bromoethanesulfonate has a molecular weight of 381.20 g/mol, XLogP of -1.67, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for sodium (3-methyl-4-oxidoperoxysulfanylphenyl) 2-bromoethanesulfonate is sourced from PubChem (CID 20688431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).