About sodium;(4-aminophenyl) ethanesulfonate;hydride
sodium;(4-aminophenyl) ethanesulfonate;hydride (PubChem CID 175557796) has the molecular formula C8H12NNaO3S
and a molecular weight of 225.25 g/mol. Its IUPAC name is sodium;(4-aminophenyl) ethanesulfonate;hydride.
Molecular Properties
| Compound Name | sodium;(4-aminophenyl) ethanesulfonate;hydride |
| PubChem CID | 175557796 |
| Molecular Formula | C8H12NNaO3S |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | sodium;(4-aminophenyl) ethanesulfonate;hydride |
| SMILES | CCS(=O)(=O)Oc1ccc(N)cc1.[H-].[Na+] |
| InChI | InChI=1S/C8H11NO3S.Na.H/c1-2-13(10,11)12-8-5-3-7(9)4-6-8;;/h3-6H,2,9H2,1H3;;/q;+1;-1 |
| InChIKey | JJXWDQWOLYOLFG-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;(4-aminophenyl) ethanesulfonate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;(4-aminophenyl) ethanesulfonate;hydride?
The IUPAC name of sodium;(4-aminophenyl) ethanesulfonate;hydride (CID 175557796) is sodium;(4-aminophenyl) ethanesulfonate;hydride.
What is the SMILES notation for sodium;(4-aminophenyl) ethanesulfonate;hydride?
The canonical SMILES for sodium;(4-aminophenyl) ethanesulfonate;hydride is CCS(=O)(=O)Oc1ccc(N)cc1.[H-].[Na+].
What is the InChIKey of sodium;(4-aminophenyl) ethanesulfonate;hydride?
The InChIKey is JJXWDQWOLYOLFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3S.Na.H/c1-2-13(10,11)12-8-5-3-7(9)4-6-8;;/h3-6H,2,9H2,1H3;;/q;+1;-1.
What are the key properties of sodium;(4-aminophenyl) ethanesulfonate;hydride?
sodium;(4-aminophenyl) ethanesulfonate;hydride has a molecular weight of 225.25 g/mol, XLogP of -1.89, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;(4-aminophenyl) ethanesulfonate;hydride is sourced from PubChem (CID 175557796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).