C11H12ClNaO5S — CID 20688596
sodium (3,5-dimethyl-4-oxidoperoxysulfanylphenyl) 3-chloropropanoate (PubChem CID 20688596) has the molecular formula C11H12ClNaO5S and a molecular weight of 314.72 g/mol. Its IUPAC name is sodium (3,5-dimethyl-4-oxidoperoxysulfanylphenyl) 3-chloropropanoate.
| Compound Name | sodium (3,5-dimethyl-4-oxidoperoxysulfanylphenyl) 3-chloropropanoate |
|---|---|
| PubChem CID | 20688596 |
| Molecular Formula | C11H12ClNaO5S |
| Molecular Weight | 314.72 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | sodium (3,5-dimethyl-4-oxidoperoxysulfanylphenyl) 3-chloropropanoate |
| SMILES | Cc1cc(OC(=O)CCCl)cc(C)c1SOO[O-].[Na+] |
| InChI | InChI=1S/C11H13ClO5S.Na/c1-7-5-9(15-10(13)3-4-12)6-8(2)11(7)18-17-16-14;/h5-6,14H,3-4H2,1-2H3;/q;+1/p-1 |
| InChIKey | RNVUWVWUXSXNML-UHFFFAOYSA-M |
| XLogP | -0.93 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.72 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|