C35H45N3O6S — CID 20692654
1-(3,4-dimethoxyphenyl)sulfonyl-2-N,3-N-bis(4-phenylbutyl)piperidine-2,3-dicarboxamide (PubChem CID 20692654) has the molecular formula C35H45N3O6S and a molecular weight of 635.83 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)sulfonyl-2-N,3-N-bis(4-phenylbutyl)piperidine-2,3-dicarboxamide.
| Compound Name | 1-(3,4-dimethoxyphenyl)sulfonyl-2-N,3-N-bis(4-phenylbutyl)piperidine-2,3-dicarboxamide |
|---|---|
| PubChem CID | 20692654 |
| Molecular Formula | C35H45N3O6S |
| Molecular Weight | 635.83 g/mol |
| Exact Mass | 635.30 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)sulfonyl-2-N,3-N-bis(4-phenylbutyl)piperidine-2,3-dicarboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC(C(=O)NCCCCc3ccccc3)C2C(=O)NCCCCc2ccccc2)cc1OC |
| InChI | InChI=1S/C35H45N3O6S/c1-43-31-22-21-29(26-32(31)44-2)45(41,42)38-25-13-20-30(34(39)36-23-11-9-18-27-14-5-3-6-15-27)33(38)35(40)37-24-12-10-19-28-16-7-4-8-17-28/h3-8,14-17,21-22,26,30,33H,9-13,18-20,23-25H2,1-2H3,(H,36,39)(H,37,40) |
| InChIKey | DGWZPPFXSNCIHP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.83 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|