C16H17F3O4S2 — CID 20693034
5-methylsulfanyl-2-[(1E,3E)-4-[4-(trifluoromethylsulfonyl)phenyl]buta-1,3-dienyl]-1,3-dioxane (PubChem CID 20693034) has the molecular formula C16H17F3O4S2 and a molecular weight of 394.44 g/mol. Its IUPAC name is 5-methylsulfanyl-2-[(1E,3E)-4-[4-(trifluoromethylsulfonyl)phenyl]buta-1,3-dienyl]-1,3-dioxane.
| Compound Name | 5-methylsulfanyl-2-[(1E,3E)-4-[4-(trifluoromethylsulfonyl)phenyl]buta-1,3-dienyl]-1,3-dioxane |
|---|---|
| PubChem CID | 20693034 |
| Molecular Formula | C16H17F3O4S2 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 5-methylsulfanyl-2-[(1E,3E)-4-[4-(trifluoromethylsulfonyl)phenyl]buta-1,3-dienyl]-1,3-dioxane |
| SMILES | CSC1COC(/C=C/C=C/c2ccc(S(=O)(=O)C(F)(F)F)cc2)OC1 |
| InChI | InChI=1S/C16H17F3O4S2/c1-24-13-10-22-15(23-11-13)5-3-2-4-12-6-8-14(9-7-12)25(20,21)16(17,18)19/h2-9,13,15H,10-11H2,1H3/b4-2+,5-3+ |
| InChIKey | ZBFVNMURKQODLI-ZUVMSYQZSA-N |
| XLogP | 3.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|