C22H21F3O5S — CID 54237510
[(2S,4R)-2-[4-[4-(trifluoromethyl)phenyl]buta-1,3-dienyl]-1,3-dioxan-4-yl] 4-methylbenzenesulfonate (PubChem CID 54237510) has the molecular formula C22H21F3O5S and a molecular weight of 454.47 g/mol. Its IUPAC name is [(2S,4R)-2-[4-[4-(trifluoromethyl)phenyl]buta-1,3-dienyl]-1,3-dioxan-4-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2S,4R)-2-[4-[4-(trifluoromethyl)phenyl]buta-1,3-dienyl]-1,3-dioxan-4-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 54237510 |
| Molecular Formula | C22H21F3O5S |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | [(2S,4R)-2-[4-[4-(trifluoromethyl)phenyl]buta-1,3-dienyl]-1,3-dioxan-4-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2CCO[C@H](C=CC=Cc3ccc(C(F)(F)F)cc3)O2)cc1 |
| InChI | InChI=1S/C22H21F3O5S/c1-16-6-12-19(13-7-16)31(26,27)30-21-14-15-28-20(29-21)5-3-2-4-17-8-10-18(11-9-17)22(23,24)25/h2-13,20-21H,14-15H2,1H3/t20-,21+/m0/s1 |
| InChIKey | QNPOADHLWWGMNC-LEWJYISDSA-N |
| XLogP | 5.08 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|