C16H17F3O3S2 — CID 20693052
difluoromethylidene-fluoro-[4-[(1E,3E)-4-(5-methylsulfanyl-1,3-dioxan-2-yl)buta-1,3-dienyl]phenyl]-oxo-λ6-sulfane (PubChem CID 20693052) has the molecular formula C16H17F3O3S2 and a molecular weight of 378.44 g/mol. Its IUPAC name is difluoromethylidene-fluoro-[4-[(1E,3E)-4-(5-methylsulfanyl-1,3-dioxan-2-yl)buta-1,3-dienyl]phenyl]-oxo-λ6-sulfane.
| Compound Name | difluoromethylidene-fluoro-[4-[(1E,3E)-4-(5-methylsulfanyl-1,3-dioxan-2-yl)buta-1,3-dienyl]phenyl]-oxo-λ6-sulfane |
|---|---|
| PubChem CID | 20693052 |
| Molecular Formula | C16H17F3O3S2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | difluoromethylidene-fluoro-[4-[(1E,3E)-4-(5-methylsulfanyl-1,3-dioxan-2-yl)buta-1,3-dienyl]phenyl]-oxo-λ6-sulfane |
| SMILES | CSC1COC(/C=C/C=C/c2ccc(S(=O)(F)=C(F)F)cc2)OC1 |
| InChI | InChI=1S/C16H17F3O3S2/c1-23-13-10-21-15(22-11-13)5-3-2-4-12-6-8-14(9-7-12)24(19,20)16(17)18/h2-9,13,15H,10-11H2,1H3/b4-2+,5-3+ |
| InChIKey | DMCIMWHBQLOMCZ-ZUVMSYQZSA-N |
| XLogP | 3.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|