C22H27F3O5S — CID 20696709
[2-[(1E,3E)-4-[4-(trifluoromethyl)cyclohexyl]buta-1,3-dienyl]-1,3-dioxan-5-yl] 4-methylbenzenesulfonate (PubChem CID 20696709) has the molecular formula C22H27F3O5S and a molecular weight of 460.51 g/mol. Its IUPAC name is [2-[(1E,3E)-4-[4-(trifluoromethyl)cyclohexyl]buta-1,3-dienyl]-1,3-dioxan-5-yl] 4-methylbenzenesulfonate.
| Compound Name | [2-[(1E,3E)-4-[4-(trifluoromethyl)cyclohexyl]buta-1,3-dienyl]-1,3-dioxan-5-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 20696709 |
| Molecular Formula | C22H27F3O5S |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | [2-[(1E,3E)-4-[4-(trifluoromethyl)cyclohexyl]buta-1,3-dienyl]-1,3-dioxan-5-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2COC(/C=C/C=C/C3CCC(C(F)(F)F)CC3)OC2)cc1 |
| InChI | InChI=1S/C22H27F3O5S/c1-16-6-12-20(13-7-16)31(26,27)30-19-14-28-21(29-15-19)5-3-2-4-17-8-10-18(11-9-17)22(23,24)25/h2-7,12-13,17-19,21H,8-11,14-15H2,1H3/b4-2+,5-3+ |
| InChIKey | RWNQTTHLQBRFPP-ZUVMSYQZSA-N |
| XLogP | 4.92 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|