C23H28O5 — CID 20693068
methyl 5,15,15-trimethyl-2,11-dioxo-7-prop-1-en-2-yl-12-oxatetracyclo[8.5.1.03,8.013,16]hexadeca-4,9-diene-4-carboxylate (PubChem CID 20693068) has the molecular formula C23H28O5 and a molecular weight of 384.47 g/mol. Its IUPAC name is methyl 5,15,15-trimethyl-2,11-dioxo-7-prop-1-en-2-yl-12-oxatetracyclo[8.5.1.03,8.013,16]hexadeca-4,9-diene-4-carboxylate.
| Compound Name | methyl 5,15,15-trimethyl-2,11-dioxo-7-prop-1-en-2-yl-12-oxatetracyclo[8.5.1.03,8.013,16]hexadeca-4,9-diene-4-carboxylate |
|---|---|
| PubChem CID | 20693068 |
| Molecular Formula | C23H28O5 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | methyl 5,15,15-trimethyl-2,11-dioxo-7-prop-1-en-2-yl-12-oxatetracyclo[8.5.1.03,8.013,16]hexadeca-4,9-diene-4-carboxylate |
| SMILES | C=C(C)C1CC(C)=C(C(=O)OC)C2C(=O)C3C4C(=CC12)C(=O)OC4CC3(C)C |
| InChI | InChI=1S/C23H28O5/c1-10(2)12-7-11(3)16(22(26)27-6)18-13(12)8-14-17-15(28-21(14)25)9-23(4,5)19(17)20(18)24/h8,12-13,15,17-19H,1,7,9H2,2-6H3 |
| InChIKey | INQOOVWJFDIQHL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|