About (6-chloro-2-methyl-3-oxo-1-pentanoylindol-2-yl) (4-methylphenyl) sulfite
(6-chloro-2-methyl-3-oxo-1-pentanoylindol-2-yl) (4-methylphenyl) sulfite (PubChem CID 20695907) has the molecular formula C21H22ClNO5S
and a molecular weight of 435.93 g/mol. Its IUPAC name is (6-chloro-2-methyl-3-oxo-1-pentanoylindol-2-yl) (4-methylphenyl) sulfite.
Molecular Properties
| Compound Name | (6-chloro-2-methyl-3-oxo-1-pentanoylindol-2-yl) (4-methylphenyl) sulfite |
| PubChem CID | 20695907 |
| Molecular Formula | C21H22ClNO5S |
| Molecular Weight | 435.93 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | (6-chloro-2-methyl-3-oxo-1-pentanoylindol-2-yl) (4-methylphenyl) sulfite |
| SMILES | CCCCC(=O)N1c2cc(Cl)ccc2C(=O)C1(C)OS(=O)Oc1ccc(C)cc1 |
| InChI | InChI=1S/C21H22ClNO5S/c1-4-5-6-19(24)23-18-13-15(22)9-12-17(18)20(25)21(23,3)28-29(26)27-16-10-7-14(2)8-11-16/h7-13H,4-6H2,1-3H3 |
| InChIKey | HBRUXWZQBYTEGP-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.93 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (6-chloro-2-methyl-3-oxo-1-pentanoylindol-2-yl) (4-methylphenyl) sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-2-methyl-3-oxo-1-pentanoylindol-2-yl) (4-methylphenyl) sulfite?
The IUPAC name of (6-chloro-2-methyl-3-oxo-1-pentanoylindol-2-yl) (4-methylphenyl) sulfite (CID 20695907) is (6-chloro-2-methyl-3-oxo-1-pentanoylindol-2-yl) (4-methylphenyl) sulfite.
What is the SMILES notation for (6-chloro-2-methyl-3-oxo-1-pentanoylindol-2-yl) (4-methylphenyl) sulfite?
The canonical SMILES for (6-chloro-2-methyl-3-oxo-1-pentanoylindol-2-yl) (4-methylphenyl) sulfite is CCCCC(=O)N1c2cc(Cl)ccc2C(=O)C1(C)OS(=O)Oc1ccc(C)cc1.
What is the InChIKey of (6-chloro-2-methyl-3-oxo-1-pentanoylindol-2-yl) (4-methylphenyl) sulfite?
The InChIKey is HBRUXWZQBYTEGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22ClNO5S/c1-4-5-6-19(24)23-18-13-15(22)9-12-17(18)20(25)21(23,3)28-29(26)27-16-10-7-14(2)8-11-16/h7-13H,4-6H2,1-3H3.
What are the key properties of (6-chloro-2-methyl-3-oxo-1-pentanoylindol-2-yl) (4-methylphenyl) sulfite?
(6-chloro-2-methyl-3-oxo-1-pentanoylindol-2-yl) (4-methylphenyl) sulfite has a molecular weight of 435.93 g/mol, XLogP of 4.76, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-2-methyl-3-oxo-1-pentanoylindol-2-yl) (4-methylphenyl) sulfite is sourced from PubChem (CID 20695907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).