C7H7ClN4 — CID 20700191
6-chloro-3,8-dimethylpurine (PubChem CID 20700191) has the molecular formula C7H7ClN4 and a molecular weight of 182.61 g/mol. Its IUPAC name is 6-chloro-3,8-dimethylpurine.
| Compound Name | 6-chloro-3,8-dimethylpurine |
|---|---|
| PubChem CID | 20700191 |
| Molecular Formula | C7H7ClN4 |
| Molecular Weight | 182.61 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | 6-chloro-3,8-dimethylpurine |
| SMILES | Cc1nc2c(Cl)ncn(C)c-2n1 |
| InChI | InChI=1S/C7H7ClN4/c1-4-10-5-6(8)9-3-12(2)7(5)11-4/h3H,1-2H3 |
| InChIKey | JGMHAHLQHUNAMN-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.61 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |