C17H30O7 — CID 20704268
2,3,4-trimethoxy-2,3,4,6,6,10,10-heptamethyl-1,7,9-trioxaspiro[4.5]decan-8-one (PubChem CID 20704268) has the molecular formula C17H30O7 and a molecular weight of 346.42 g/mol. Its IUPAC name is 2,3,4-trimethoxy-2,3,4,6,6,10,10-heptamethyl-1,7,9-trioxaspiro[4.5]decan-8-one.
| Compound Name | 2,3,4-trimethoxy-2,3,4,6,6,10,10-heptamethyl-1,7,9-trioxaspiro[4.5]decan-8-one |
|---|---|
| PubChem CID | 20704268 |
| Molecular Formula | C17H30O7 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 2,3,4-trimethoxy-2,3,4,6,6,10,10-heptamethyl-1,7,9-trioxaspiro[4.5]decan-8-one |
| SMILES | COC1(C)OC2(C(C)(C)OC(=O)OC2(C)C)C(C)(OC)C1(C)OC |
| InChI | InChI=1S/C17H30O7/c1-12(2)17(13(3,4)23-11(18)22-12)15(6,20-9)14(5,19-8)16(7,21-10)24-17/h1-10H3 |
| InChIKey | WLUAQIZKDDHLEX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |