C17H14N4O5 — CID 20704482
2-[[(1R,9S,10R)-5-imino-8,11-dioxa-2,6-diazatricyclo[7.2.1.02,7]dodeca-3,6-dien-10-yl]methoxy]isoindole-1,3-dione (PubChem CID 20704482) has the molecular formula C17H14N4O5 and a molecular weight of 354.32 g/mol. Its IUPAC name is 2-[[(1R,9S,10R)-5-imino-8,11-dioxa-2,6-diazatricyclo[7.2.1.02,7]dodeca-3,6-dien-10-yl]methoxy]isoindole-1,3-dione.
| Compound Name | 2-[[(1R,9S,10R)-5-imino-8,11-dioxa-2,6-diazatricyclo[7.2.1.02,7]dodeca-3,6-dien-10-yl]methoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 20704482 |
| Molecular Formula | C17H14N4O5 |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 2-[[(1R,9S,10R)-5-imino-8,11-dioxa-2,6-diazatricyclo[7.2.1.02,7]dodeca-3,6-dien-10-yl]methoxy]isoindole-1,3-dione |
| SMILES | [H]/N=c1\ccn2c(n1)O[C@H]1C[C@H]2O[C@@H]1CON1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H14N4O5/c18-13-5-6-20-14-7-11(26-17(20)19-13)12(25-14)8-24-21-15(22)9-3-1-2-4-10(9)16(21)23/h1-6,11-12,14,18H,7-8H2/b18-13+/t11-,12+,14+/m0/s1 |
| InChIKey | CWFAYHDXUJWHEC-NQMXVKDASA-N |
| XLogP | 0.64 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|