C11H14ClN3O5 — CID 90677692
[(2R,4R,5R,6S)-4-(hydroxymethyl)-10-imino-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-5-yl] acetate;hydrochloride (PubChem CID 90677692) has the molecular formula C11H14ClN3O5 and a molecular weight of 303.70 g/mol. Its IUPAC name is [(2R,4R,5R,6S)-4-(hydroxymethyl)-10-imino-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-5-yl] acetate;hydrochloride.
| Compound Name | [(2R,4R,5R,6S)-4-(hydroxymethyl)-10-imino-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-5-yl] acetate;hydrochloride |
|---|---|
| PubChem CID | 90677692 |
| Molecular Formula | C11H14ClN3O5 |
| Molecular Weight | 303.70 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | [(2R,4R,5R,6S)-4-(hydroxymethyl)-10-imino-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-5-yl] acetate;hydrochloride |
| SMILES | Cl.[H]/N=c1\ccn2c(n1)O[C@H]1[C@H](OC(C)=O)[C@@H](CO)O[C@H]12 |
| InChI | InChI=1S/C11H13N3O5.ClH/c1-5(16)17-8-6(4-15)18-10-9(8)19-11-13-7(12)2-3-14(10)11;/h2-3,6,8-10,12,15H,4H2,1H3;1H/b12-7+;/t6-,8-,9+,10-;/m1./s1 |
| InChIKey | UFGFSLFERDWKRA-JAOSTIAXSA-N |
| XLogP | -0.63 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.70 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |