C18H27N3O5 — CID 90677705
[(2R,4R,5R,6S)-4-(hydroxymethyl)-10-imino-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-5-yl] nonanoate (PubChem CID 90677705) has the molecular formula C18H27N3O5 and a molecular weight of 365.43 g/mol. Its IUPAC name is [(2R,4R,5R,6S)-4-(hydroxymethyl)-10-imino-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-5-yl] nonanoate.
| Compound Name | [(2R,4R,5R,6S)-4-(hydroxymethyl)-10-imino-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-5-yl] nonanoate |
|---|---|
| PubChem CID | 90677705 |
| Molecular Formula | C18H27N3O5 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | [(2R,4R,5R,6S)-4-(hydroxymethyl)-10-imino-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-5-yl] nonanoate |
| SMILES | [H]/N=c1\ccn2c(n1)O[C@H]1[C@H](OC(=O)CCCCCCCC)[C@@H](CO)O[C@H]12 |
| InChI | InChI=1S/C18H27N3O5/c1-2-3-4-5-6-7-8-14(23)25-15-12(11-22)24-17-16(15)26-18-20-13(19)9-10-21(17)18/h9-10,12,15-17,19,22H,2-8,11H2,1H3/b19-13+/t12-,15-,16+,17-/m1/s1 |
| InChIKey | SEGBPIYQSHZGTL-SNGXBDPMSA-N |
| XLogP | 1.68 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|