C39H68ClN3O6S2 — CID 90669268
[(2R,4R,5R,6R)-5-(11-butylsulfanylundecanoyloxy)-10-imino-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-4-yl]methyl 11-butylsulfanylundecanoate;hydrochloride (PubChem CID 90669268) has the molecular formula C39H68ClN3O6S2 and a molecular weight of 774.57 g/mol. Its IUPAC name is [(2R,4R,5R,6R)-5-(11-butylsulfanylundecanoyloxy)-10-imino-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-4-yl]methyl 11-butylsulfanylundecanoate;hydrochloride.
| Compound Name | [(2R,4R,5R,6R)-5-(11-butylsulfanylundecanoyloxy)-10-imino-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-4-yl]methyl 11-butylsulfanylundecanoate;hydrochloride |
|---|---|
| PubChem CID | 90669268 |
| Molecular Formula | C39H68ClN3O6S2 |
| Molecular Weight | 774.57 g/mol |
| Exact Mass | 773.42 |
| IUPAC Name | [(2R,4R,5R,6R)-5-(11-butylsulfanylundecanoyloxy)-10-imino-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-4-yl]methyl 11-butylsulfanylundecanoate;hydrochloride |
| SMILES | Cl.[H]/N=c1\ccn2c(n1)O[C@@H]1[C@H](OC(=O)CCCCCCCCCCSCCCC)[C@@H](COC(=O)CCCCCCCCCCSCCCC)O[C@H]12 |
| InChI | InChI=1S/C39H67N3O6S2.ClH/c1-3-5-27-49-29-21-17-13-9-7-11-15-19-23-34(43)45-31-32-36(37-38(46-32)42-26-25-33(40)41-39(42)48-37)47-35(44)24-20-16-12-8-10-14-18-22-30-50-28-6-4-2;/h25-26,32,36-38,40H,3-24,27-31H2,1-2H3;1H/b40-33+;/t32-,36-,37-,38-;/m1./s1 |
| InChIKey | LFAJTIFCNMJIGV-DMAYUINVSA-N |
| XLogP | 9.99 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.57 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|