C29H48ClN3O6 — CID 90677744
[(2R,4R,5R,6S)-5-decanoyloxy-10-imino-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-4-yl]methyl decanoate;hydrochloride (PubChem CID 90677744) has the molecular formula C29H48ClN3O6 and a molecular weight of 570.17 g/mol. Its IUPAC name is [(2R,4R,5R,6S)-5-decanoyloxy-10-imino-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-4-yl]methyl decanoate;hydrochloride.
| Compound Name | [(2R,4R,5R,6S)-5-decanoyloxy-10-imino-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-4-yl]methyl decanoate;hydrochloride |
|---|---|
| PubChem CID | 90677744 |
| Molecular Formula | C29H48ClN3O6 |
| Molecular Weight | 570.17 g/mol |
| Exact Mass | 569.32 |
| IUPAC Name | [(2R,4R,5R,6S)-5-decanoyloxy-10-imino-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-4-yl]methyl decanoate;hydrochloride |
| SMILES | Cl.[H]/N=c1\ccn2c(n1)O[C@H]1[C@H](OC(=O)CCCCCCCCC)[C@@H](COC(=O)CCCCCCCCC)O[C@H]12 |
| InChI | InChI=1S/C29H47N3O6.ClH/c1-3-5-7-9-11-13-15-17-24(33)35-21-22-26(37-25(34)18-16-14-12-10-8-6-4-2)27-28(36-22)32-20-19-23(30)31-29(32)38-27;/h19-20,22,26-28,30H,3-18,21H2,1-2H3;1H/b30-23+;/t22-,26-,27+,28-;/m1./s1 |
| InChIKey | YIFDYVLQLGOJIL-DXDTXCGPSA-N |
| XLogP | 6.18 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.17 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|