C45H75N3O6 — CID 90677769
[(2R,4R,5R,6S)-10-imino-5-[(Z)-octadec-9-enoyl]oxy-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-4-yl]methyl (Z)-octadec-9-enoate (PubChem CID 90677769) has the molecular formula C45H75N3O6 and a molecular weight of 754.11 g/mol. Its IUPAC name is [(2R,4R,5R,6S)-10-imino-5-[(Z)-octadec-9-enoyl]oxy-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-4-yl]methyl (Z)-octadec-9-enoate.
| Compound Name | [(2R,4R,5R,6S)-10-imino-5-[(Z)-octadec-9-enoyl]oxy-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-4-yl]methyl (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 90677769 |
| Molecular Formula | C45H75N3O6 |
| Molecular Weight | 754.11 g/mol |
| Exact Mass | 753.57 |
| IUPAC Name | [(2R,4R,5R,6S)-10-imino-5-[(Z)-octadec-9-enoyl]oxy-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-4-yl]methyl (Z)-octadec-9-enoate |
| SMILES | [H]/N=c1\ccn2c(n1)O[C@H]1[C@H](OC(=O)CCCCCCC/C=C\CCCCCCCC)[C@@H](COC(=O)CCCCCCC/C=C\CCCCCCCC)O[C@H]12 |
| InChI | InChI=1S/C45H75N3O6/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-40(49)51-37-38-42(43-44(52-38)48-36-35-39(46)47-45(48)54-43)53-41(50)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,35-36,38,42-44,46H,3-16,21-34,37H2,1-2H3/b19-17-,20-18-,46-39+/t38-,42-,43+,44-/m1/s1 |
| InChIKey | VIDCWAXAQKBHMD-AEHZFVRLSA-N |
| XLogP | 11.55 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.11 |
| LogP ≤ 5 | 11.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|