C22H27N3O6 — CID 90677761
[(2R,4R,5R,6S)-5-acetyloxy-10-imino-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-4-yl]methyl adamantane-1-carboxylate (PubChem CID 90677761) has the molecular formula C22H27N3O6 and a molecular weight of 429.47 g/mol. Its IUPAC name is [(2R,4R,5R,6S)-5-acetyloxy-10-imino-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-4-yl]methyl adamantane-1-carboxylate.
| Compound Name | [(2R,4R,5R,6S)-5-acetyloxy-10-imino-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-4-yl]methyl adamantane-1-carboxylate |
|---|---|
| PubChem CID | 90677761 |
| Molecular Formula | C22H27N3O6 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | [(2R,4R,5R,6S)-5-acetyloxy-10-imino-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-4-yl]methyl adamantane-1-carboxylate |
| SMILES | [H]/N=c1\ccn2c(n1)O[C@H]1[C@H](OC(C)=O)[C@@H](COC(=O)C34CC5CC(CC(C5)C3)C4)O[C@H]12 |
| InChI | InChI=1S/C22H27N3O6/c1-11(26)29-17-15(30-19-18(17)31-21-24-16(23)2-3-25(19)21)10-28-20(27)22-7-12-4-13(8-22)6-14(5-12)9-22/h2-3,12-15,17-19,23H,4-10H2,1H3/b23-16+/t12?,13?,14?,15-,17-,18+,19-,22?/m1/s1 |
| InChIKey | RTZOQJNGVZSHES-MRTXKAGTSA-N |
| XLogP | 1.71 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |